The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-(MP3-320 (Size: 75.01 MB)
| | | the leathercoated minds - a trip down sunset strip 1967 front large.jpg | 1.3 MB |
| | | the leathercoated minds - a trip down sunset strip 1967 cd.jpg | 529.28 KB |
| | | the leathercoated minds - a trip down sunset strip 1967 back.jpeg | 145.39 KB |
| | | the leathercoated minds - a trip down sunset strip 1967 back 2 large.jpg | 1.32 MB |
| | | the leathercoated minds - a trip down sunset strip 1967 front small.jpg | 27.11 KB |
| | | the leathercoated minds - a trip down sunset strip 1967 inside 2.jpg | 968.43 KB |
| | | the leathercoated minds - a trip down sunset strip 1967 inside.jpg | 1020.62 KB |
| | | the leathercoated minds - a trip down sunset strip 1967 inside gatefold.jpg | 2.12 MB |
| | | the leathercoated minds - a trip down sunset strip 1967 inside gatefold 2.jpg | 1.8 MB |
| | | 12-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Pot Luck.mp3 | 5 MB |
| | | 11-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Along Comes Mary.mp3 | 4.87 MB |
| | | 05-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Sunshine Superman.mp3 | 7.71 MB |
| | | 04-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Over Under Sideways Down.mp3 | 5.13 MB |
| | | 03-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Psychotic Reaction.mp3 | 5.76 MB |
| | | 02-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Sunset & Clark.mp3 | 4.52 MB |
| | | 06-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Non-Stop.mp3 | 5.16 MB |
| | | 07-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Arriba.mp3 | 5.61 MB |
| | | 10-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Puff (The Magic Dragon).mp3 | 5.66 MB |
| | | 09-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Mr Tambourine Man.mp3 | 5.1 MB |
| | | 08-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Kicks.mp3 | 6.35 MB |
| | | 01-The Leathercoated Minds-A Trip Down Sunset Strip-(1967)-Eight Miles High.mp3 | 4.97 MB |
Related Torrents
| torrent name |
size |
seed |
leech |
|
|
51.04 MB |
0 |
0 |
Sharing Widget
All Comments